C17H17Cl2FN2O4 — CID 20732370
2-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid (PubChem CID 20732370) has the molecular formula C17H17Cl2FN2O4 and a molecular weight of 403.24 g/mol. Its IUPAC name is 2-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid.
| Compound Name | 2-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid |
|---|---|
| PubChem CID | 20732370 |
| Molecular Formula | C17H17Cl2FN2O4 |
| Molecular Weight | 403.24 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-[[3,5-dichloro-6-fluoro-4-(4-hydroxy-3-methyl-5-propan-2-ylphenoxy)-2-pyridinyl]amino]acetic acid |
| SMILES | Cc1cc(Oc2c(Cl)c(F)nc(NCC(=O)O)c2Cl)cc(C(C)C)c1O |
| InChI | InChI=1S/C17H17Cl2FN2O4/c1-7(2)10-5-9(4-8(3)14(10)25)26-15-12(18)16(20)22-17(13(15)19)21-6-11(23)24/h4-5,7,25H,6H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | GYILSVWDKQNXFG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.24 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|