C19H22N2O — CID 20734254
(4Z)-2-tert-butyl-6-methyl-4-[[(4-methylphenyl)diazenyl]methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 20734254) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (4Z)-2-tert-butyl-6-methyl-4-[[(4-methylphenyl)diazenyl]methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | (4Z)-2-tert-butyl-6-methyl-4-[[(4-methylphenyl)diazenyl]methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 20734254 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (4Z)-2-tert-butyl-6-methyl-4-[[(4-methylphenyl)diazenyl]methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC1=C/C(=C/N=N/c2ccc(C)cc2)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C19H22N2O/c1-13-6-8-16(9-7-13)21-20-12-15-10-14(2)18(22)17(11-15)19(3,4)5/h6-12H,1-5H3/b15-12-,21-20+ |
| InChIKey | JTKPWUUVWZRWOH-OMSNLGENSA-N |
| XLogP | 5.46 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|