C4H6N2O2 — CID 20735859
N-isocyano-1,1-dimethoxymethanimine (PubChem CID 20735859) has the molecular formula C4H6N2O2 and a molecular weight of 114.10 g/mol. Its IUPAC name is N-isocyano-1,1-dimethoxymethanimine.
| Compound Name | N-isocyano-1,1-dimethoxymethanimine |
|---|---|
| PubChem CID | 20735859 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | N-isocyano-1,1-dimethoxymethanimine |
| SMILES | [C-]#[N+]N=C(OC)OC |
| InChI | InChI=1S/C4H6N2O2/c1-5-6-4(7-2)8-3/h2-3H3 |
| InChIKey | PWTGCLBLDDQBJL-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 35.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|