C9H16ClNO2 — CID 27001632
N-[(1S,2S)-2-chlorocyclohexyl]-1,1-dimethoxymethanimine (PubChem CID 27001632) has the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. Its IUPAC name is N-[(1S,2S)-2-chlorocyclohexyl]-1,1-dimethoxymethanimine.
| Compound Name | N-[(1S,2S)-2-chlorocyclohexyl]-1,1-dimethoxymethanimine |
|---|---|
| PubChem CID | 27001632 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-[(1S,2S)-2-chlorocyclohexyl]-1,1-dimethoxymethanimine |
| SMILES | COC(=N[C@H]1CCCC[C@@H]1Cl)OC |
| InChI | InChI=1S/C9H16ClNO2/c1-12-9(13-2)11-8-6-4-3-5-7(8)10/h7-8H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | ZORXBKLRPBUTNF-YUMQZZPRSA-N |
| XLogP | 2.19 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|