C24H44Cl2CoN2 — CID 140738520
2-N,3-N-bis(2-tert-butylcyclohexyl)butane-2,3-diimine;dichlorocobalt (PubChem CID 140738520) has the molecular formula C24H44Cl2CoN2 and a molecular weight of 490.47 g/mol. Its IUPAC name is 2-N,3-N-bis(2-tert-butylcyclohexyl)butane-2,3-diimine;dichlorocobalt.
| Compound Name | 2-N,3-N-bis(2-tert-butylcyclohexyl)butane-2,3-diimine;dichlorocobalt |
|---|---|
| PubChem CID | 140738520 |
| Molecular Formula | C24H44Cl2CoN2 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 2-N,3-N-bis(2-tert-butylcyclohexyl)butane-2,3-diimine;dichlorocobalt |
| SMILES | CC(=N\C1CCCCC1C(C)(C)C)/C(C)=N/C1CCCCC1C(C)(C)C.Cl[Co]Cl |
| InChI | InChI=1S/C24H44N2.2ClH.Co/c1-17(25-21-15-11-9-13-19(21)23(3,4)5)18(2)26-22-16-12-10-14-20(22)24(6,7)8;;;/h19-22H,9-16H2,1-8H3;2*1H;/q;;;+2/p-2/b25-17+,26-18+;;; |
| InChIKey | PJOOQNDGDGCSBM-HDZVPRFUSA-L |
| XLogP | 8.49 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|