C26H26N4O6 — CID 20737172
3-[2-[3-[4-(dimethylamino)-2-methylphenyl]imino-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]ethylperoxymethyl]benzoic acid (PubChem CID 20737172) has the molecular formula C26H26N4O6 and a molecular weight of 490.52 g/mol. Its IUPAC name is 3-[2-[3-[4-(dimethylamino)-2-methylphenyl]imino-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]ethylperoxymethyl]benzoic acid.
| Compound Name | 3-[2-[3-[4-(dimethylamino)-2-methylphenyl]imino-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]ethylperoxymethyl]benzoic acid |
|---|---|
| PubChem CID | 20737172 |
| Molecular Formula | C26H26N4O6 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 3-[2-[3-[4-(dimethylamino)-2-methylphenyl]imino-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]ethylperoxymethyl]benzoic acid |
| SMILES | [C-]#[N+]C1=C(C)/C(=N/c2ccc(N(C)C)cc2C)C(=O)N(CCOOCc2cccc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C26H26N4O6/c1-16-13-20(29(4)5)9-10-21(16)28-23-17(2)22(27-3)24(31)30(25(23)32)11-12-35-36-15-18-7-6-8-19(14-18)26(33)34/h6-10,13-14H,11-12,15H2,1-2,4-5H3,(H,33,34)/b28-23- |
| InChIKey | HKVPWXOMQJBBLH-NFFVHWSESA-N |
| XLogP | 3.54 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|