C29H44O2 — CID 20739608
(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]spiro[2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4,1'-cyclopropane]-7-one (PubChem CID 20739608) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]spiro[2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4,1'-cyclopropane]-7-one.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]spiro[2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4,1'-cyclopropane]-7-one |
|---|---|
| PubChem CID | 20739608 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]spiro[2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4,1'-cyclopropane]-7-one |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(=O)C=C4C5(CC5)[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H44O2/c1-18(2)7-6-8-19(3)20-9-10-21-26-22(11-13-27(20,21)4)28(5)14-12-25(31)29(15-16-29)24(28)17-23(26)30/h7,17,19-22,25-26,31H,6,8-16H2,1-5H3/t19-,20-,21+,22+,25+,26+,27-,28-/m1/s1 |
| InChIKey | OTYIJFPOTTUMMH-LDZNZAOOSA-N |
| XLogP | 6.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|