C16H26O4 — CID 20740944
1-[2,2-bis(prop-2-enoxymethyl)butoxy]but-3-en-2-one (PubChem CID 20740944) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[2,2-bis(prop-2-enoxymethyl)butoxy]but-3-en-2-one.
| Compound Name | 1-[2,2-bis(prop-2-enoxymethyl)butoxy]but-3-en-2-one |
|---|---|
| PubChem CID | 20740944 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-[2,2-bis(prop-2-enoxymethyl)butoxy]but-3-en-2-one |
| SMILES | C=CCOCC(CC)(COCC=C)COCC(=O)C=C |
| InChI | InChI=1S/C16H26O4/c1-5-9-18-12-16(8-4,13-19-10-6-2)14-20-11-15(17)7-3/h5-7H,1-3,8-14H2,4H3 |
| InChIKey | KKLAKXCSXFMMPJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|