C12H17FN2O7 — CID 20742944
(5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-[2-(2-methoxyethoxy)ethoxy]acetate (PubChem CID 20742944) has the molecular formula C12H17FN2O7 and a molecular weight of 320.27 g/mol. Its IUPAC name is (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-[2-(2-methoxyethoxy)ethoxy]acetate.
| Compound Name | (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-[2-(2-methoxyethoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 20742944 |
| Molecular Formula | C12H17FN2O7 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (5-fluoro-2,4-dioxo-1H-pyrimidin-3-yl)methyl 2-[2-(2-methoxyethoxy)ethoxy]acetate |
| SMILES | COCCOCCOCC(=O)OCn1c(=O)[nH]cc(F)c1=O |
| InChI | InChI=1S/C12H17FN2O7/c1-19-2-3-20-4-5-21-7-10(16)22-8-15-11(17)9(13)6-14-12(15)18/h6H,2-5,7-8H2,1H3,(H,14,18) |
| InChIKey | JXCWRTFDZUMXQB-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|