C28H45IN4O8S — CID 20744616
2-[[2-(4-hydroxy-3-iodo-5-nitrophenyl)acetyl]amino]-4-methyl-N-[4-methyl-1-[(5-methyl-1-methylsulfonylhexan-3-yl)amino]-1-oxopentan-2-yl]pentanamide (PubChem CID 20744616) has the molecular formula C28H45IN4O8S and a molecular weight of 724.66 g/mol. Its IUPAC name is 2-[[2-(4-hydroxy-3-iodo-5-nitrophenyl)acetyl]amino]-4-methyl-N-[4-methyl-1-[(5-methyl-1-methylsulfonylhexan-3-yl)amino]-1-oxopentan-2-yl]pentanamide.
| Compound Name | 2-[[2-(4-hydroxy-3-iodo-5-nitrophenyl)acetyl]amino]-4-methyl-N-[4-methyl-1-[(5-methyl-1-methylsulfonylhexan-3-yl)amino]-1-oxopentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 20744616 |
| Molecular Formula | C28H45IN4O8S |
| Molecular Weight | 724.66 g/mol |
| Exact Mass | 724.20 |
| IUPAC Name | 2-[[2-(4-hydroxy-3-iodo-5-nitrophenyl)acetyl]amino]-4-methyl-N-[4-methyl-1-[(5-methyl-1-methylsulfonylhexan-3-yl)amino]-1-oxopentan-2-yl]pentanamide |
| SMILES | CC(C)CC(CCS(C)(=O)=O)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)Cc1cc(I)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H45IN4O8S/c1-16(2)10-20(8-9-42(7,40)41)30-27(36)23(12-18(5)6)32-28(37)22(11-17(3)4)31-25(34)15-19-13-21(29)26(35)24(14-19)33(38)39/h13-14,16-18,20,22-23,35H,8-12,15H2,1-7H3,(H,30,36)(H,31,34)(H,32,37) |
| InChIKey | ORZADIQRTKOJRV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 184.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|