C14H18IrNO2S- — CID 20746438
iridium;pentane-2,4-diol;2-(3H-thiophen-3-id-2-yl)pyridine (PubChem CID 20746438) has the molecular formula C14H18IrNO2S- and a molecular weight of 456.59 g/mol. Its IUPAC name is iridium;pentane-2,4-diol;2-(3H-thiophen-3-id-2-yl)pyridine.
| Compound Name | iridium;pentane-2,4-diol;2-(3H-thiophen-3-id-2-yl)pyridine |
|---|---|
| PubChem CID | 20746438 |
| Molecular Formula | C14H18IrNO2S- |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | iridium;pentane-2,4-diol;2-(3H-thiophen-3-id-2-yl)pyridine |
| SMILES | CC(O)CC(C)O.[Ir].[c-]1ccsc1-c1ccccn1 |
| InChI | InChI=1S/C9H6NS.C5H12O2.Ir/c1-2-6-10-8(4-1)9-5-3-7-11-9;1-4(6)3-5(2)7;/h1-4,6-7H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | VEMLIBGOADJDOO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|