C24H35N4O3S+ — CID 20746861
[4-[4-[4-(2-ethylhexoxy)phenyl]sulfonylpiperazin-1-yl]phenyl]iminoazanium (PubChem CID 20746861) has the molecular formula C24H35N4O3S+ and a molecular weight of 459.64 g/mol. Its IUPAC name is [4-[4-[4-(2-ethylhexoxy)phenyl]sulfonylpiperazin-1-yl]phenyl]iminoazanium.
| Compound Name | [4-[4-[4-(2-ethylhexoxy)phenyl]sulfonylpiperazin-1-yl]phenyl]iminoazanium |
|---|---|
| PubChem CID | 20746861 |
| Molecular Formula | C24H35N4O3S+ |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | [4-[4-[4-(2-ethylhexoxy)phenyl]sulfonylpiperazin-1-yl]phenyl]iminoazanium |
| SMILES | CCCCC(CC)COc1ccc(S(=O)(=O)N2CCN(c3ccc(N=[NH2+])cc3)CC2)cc1 |
| InChI | InChI=1S/C24H34N4O3S/c1-3-5-6-20(4-2)19-31-23-11-13-24(14-12-23)32(29,30)28-17-15-27(16-18-28)22-9-7-21(26-25)8-10-22/h7-14,20,25H,3-6,15-19H2,1-2H3/p+1 |
| InChIKey | SCTHZNYRESHRLA-UHFFFAOYSA-O |
| XLogP | 3.64 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|