C31H48O7Si — CID 20747184
[(8S,9S,10R,13S,14S,17R)-17-[2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyacetyl]-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 20747184) has the molecular formula C31H48O7Si and a molecular weight of 560.80 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-17-[2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyacetyl]-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-17-[2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyacetyl]-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 20747184 |
| Molecular Formula | C31H48O7Si |
| Molecular Weight | 560.80 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-17-[2-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyacetyl]-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C(=O)C(O)O[Si](C)(C)C(C)(C)C)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C31H48O7Si/c1-9-10-24(34)37-31(26(35)27(36)38-39(7,8)28(2,3)4)16-14-22-21-12-11-19-17-20(32)13-15-29(19,5)25(21)23(33)18-30(22,31)6/h13,15,17,21-23,25,27,33,36H,9-12,14,16,18H2,1-8H3/t21-,22-,23?,25+,27?,29-,30-,31-/m0/s1 |
| InChIKey | DKCZTMRYFHSKTF-PUBBAMDZSA-N |
| XLogP | 5.26 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.80 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|