C25H33ClO6 — CID 22805321
[(8S,9S,10R,13S,14S,17R)-17-(2-chloro-2-hydroxyacetyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 22805321) has the molecular formula C25H33ClO6 and a molecular weight of 464.99 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-17-(2-chloro-2-hydroxyacetyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-17-(2-chloro-2-hydroxyacetyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 22805321 |
| Molecular Formula | C25H33ClO6 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-17-(2-chloro-2-hydroxyacetyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C(=O)C(O)Cl)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C25H33ClO6/c1-4-5-19(29)32-25(21(30)22(26)31)11-9-17-16-7-6-14-12-15(27)8-10-23(14,2)20(16)18(28)13-24(17,25)3/h8,10,12,16-18,20,22,28,31H,4-7,9,11,13H2,1-3H3/t16-,17-,18?,20+,22?,23-,24-,25-/m0/s1 |
| InChIKey | RATHZWJSFQIJEI-OPSDAQPMSA-N |
| XLogP | 3.47 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|