C37H24F3N2O6P — CID 20750500
5-[2-[2-diphenylphosphoryl-3-methyl-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione (PubChem CID 20750500) has the molecular formula C37H24F3N2O6P and a molecular weight of 680.58 g/mol. Its IUPAC name is 5-[2-[2-diphenylphosphoryl-3-methyl-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[2-diphenylphosphoryl-3-methyl-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 20750500 |
| Molecular Formula | C37H24F3N2O6P |
| Molecular Weight | 680.58 g/mol |
| Exact Mass | 680.13 |
| IUPAC Name | 5-[2-[2-diphenylphosphoryl-3-methyl-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindol-5-yl]oxy-2-methylisoindole-1,3-dione |
| SMILES | Cc1cc(C(F)(F)F)cc(N2C(=O)c3ccc(Oc4ccc5c(c4)C(=O)N(C)C5=O)cc3C2=O)c1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H24F3N2O6P/c1-21-17-22(37(38,39)40)18-31(32(21)49(47,25-9-5-3-6-10-25)26-11-7-4-8-12-26)42-35(45)28-16-14-24(20-30(28)36(42)46)48-23-13-15-27-29(19-23)34(44)41(2)33(27)43/h3-20H,1-2H3 |
| InChIKey | MZKUOWLKJKDAIY-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|