C10H9N — CID 20756388
N,N-dimethylocta-1,2,3,4,5,6,7-heptaen-1-amine (PubChem CID 20756388) has the molecular formula C10H9N and a molecular weight of 143.19 g/mol. Its IUPAC name is N,N-dimethylocta-1,2,3,4,5,6,7-heptaen-1-amine.
| Compound Name | N,N-dimethylocta-1,2,3,4,5,6,7-heptaen-1-amine |
|---|---|
| PubChem CID | 20756388 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | N,N-dimethylocta-1,2,3,4,5,6,7-heptaen-1-amine |
| SMILES | C=C=C=C=C=C=C=CN(C)C |
| InChI | InChI=1S/C10H9N/c1-4-5-6-7-8-9-10-11(2)3/h10H,1H2,2-3H3 |
| InChIKey | VMFQTTRHTGXLNK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |