C12H26O4 — CID 20759498
2,3,4,5-tetramethoxy-2,5-dimethylhexane (PubChem CID 20759498) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2,3,4,5-tetramethoxy-2,5-dimethylhexane.
| Compound Name | 2,3,4,5-tetramethoxy-2,5-dimethylhexane |
|---|---|
| PubChem CID | 20759498 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 2,3,4,5-tetramethoxy-2,5-dimethylhexane |
| SMILES | COC(C(OC)C(C)(C)OC)C(C)(C)OC |
| InChI | InChI=1S/C12H26O4/c1-11(2,15-7)9(13-5)10(14-6)12(3,4)16-8/h9-10H,1-8H3 |
| InChIKey | UABVUFPKQRUDOC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |