N-dimethyl-N-(7-oxooctyl)boronamidic acid

C10H22BNO2 — CID 20759757

IUPACN-dimethyl-N-(7-oxooctyl)boronamidic acid
SMILESCB(O)N(C)CCCCCCC(C)=O
InChIInChI=1S/C10H22BNO2/c1-10(13)8-6-4-5-7-9-12(3)11(2)14/h14H,4-9H2,1-3H3
InChIKeyCCXICYCEGNYBEG-UHFFFAOYSA-N
MW199.10 g/mol
LogP1.57
Rot. Bonds8

About N-dimethyl-N-(7-oxooctyl)boronamidic acid

N-dimethyl-N-(7-oxooctyl)boronamidic acid (PubChem CID 20759757) has the molecular formula C10H22BNO2 and a molecular weight of 199.10 g/mol. Its IUPAC name is N-dimethyl-N-(7-oxooctyl)boronamidic acid.

Molecular Properties

Compound NameN-dimethyl-N-(7-oxooctyl)boronamidic acid
PubChem CID20759757
Molecular FormulaC10H22BNO2
Molecular Weight199.10 g/mol
Exact Mass199.17
IUPAC NameN-dimethyl-N-(7-oxooctyl)boronamidic acid
SMILESCB(O)N(C)CCCCCCC(C)=O
InChIInChI=1S/C10H22BNO2/c1-10(13)8-6-4-5-7-9-12(3)11(2)14/h14H,4-9H2,1-3H3
InChIKeyCCXICYCEGNYBEG-UHFFFAOYSA-N
XLogP1.57
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.10
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze N-dimethyl-N-(7-oxooctyl)boronamidic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-dimethyl-N-(7-oxooctyl)boronamidic acid?
The IUPAC name of N-dimethyl-N-(7-oxooctyl)boronamidic acid (CID 20759757) is N-dimethyl-N-(7-oxooctyl)boronamidic acid.
What is the SMILES notation for N-dimethyl-N-(7-oxooctyl)boronamidic acid?
The canonical SMILES for N-dimethyl-N-(7-oxooctyl)boronamidic acid is CB(O)N(C)CCCCCCC(C)=O.
What is the InChIKey of N-dimethyl-N-(7-oxooctyl)boronamidic acid?
The InChIKey is CCXICYCEGNYBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22BNO2/c1-10(13)8-6-4-5-7-9-12(3)11(2)14/h14H,4-9H2,1-3H3.
What are the key properties of N-dimethyl-N-(7-oxooctyl)boronamidic acid?
N-dimethyl-N-(7-oxooctyl)boronamidic acid has a molecular weight of 199.10 g/mol, XLogP of 1.57, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-dimethyl-N-(7-oxooctyl)boronamidic acid is sourced from PubChem (CID 20759757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).