C14H13ClN2OS — CID 20763364
N'-[4-[(4-chlorophenyl)methylsulfanyl]phenyl]-N-hydroxymethanimidamide (PubChem CID 20763364) has the molecular formula C14H13ClN2OS and a molecular weight of 292.79 g/mol. Its IUPAC name is N'-[4-[(4-chlorophenyl)methylsulfanyl]phenyl]-N-hydroxymethanimidamide.
| Compound Name | N'-[4-[(4-chlorophenyl)methylsulfanyl]phenyl]-N-hydroxymethanimidamide |
|---|---|
| PubChem CID | 20763364 |
| Molecular Formula | C14H13ClN2OS |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | N'-[4-[(4-chlorophenyl)methylsulfanyl]phenyl]-N-hydroxymethanimidamide |
| SMILES | ON/C=N/c1ccc(SCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H13ClN2OS/c15-12-3-1-11(2-4-12)9-19-14-7-5-13(6-8-14)16-10-17-18/h1-8,10,18H,9H2,(H,16,17) |
| InChIKey | DGNVGSCJGRIIJG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|