C27H32N4O6S — CID 20766612
N'-[1-[1-(benzenesulfonyl)piperidin-4-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide (PubChem CID 20766612) has the molecular formula C27H32N4O6S and a molecular weight of 540.64 g/mol. Its IUPAC name is N'-[1-[1-(benzenesulfonyl)piperidin-4-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide.
| Compound Name | N'-[1-[1-(benzenesulfonyl)piperidin-4-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 20766612 |
| Molecular Formula | C27H32N4O6S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | N'-[1-[1-(benzenesulfonyl)piperidin-4-yl]-2-methylpropan-2-yl]-N-[3-methoxy-4-(1,3-oxazol-5-yl)phenyl]oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NC(C)(C)CC2CCN(S(=O)(=O)c3ccccc3)CC2)ccc1-c1cnco1 |
| InChI | InChI=1S/C27H32N4O6S/c1-27(2,16-19-11-13-31(14-12-19)38(34,35)21-7-5-4-6-8-21)30-26(33)25(32)29-20-9-10-22(23(15-20)36-3)24-17-28-18-37-24/h4-10,15,17-19H,11-14,16H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | PCNNLGTUWDSETN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|