C21H21ClO4S — CID 20768127
ethyl 2-[[4-(2-chloro-4-formylphenyl)sulfanyl-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetate (PubChem CID 20768127) has the molecular formula C21H21ClO4S and a molecular weight of 404.92 g/mol. Its IUPAC name is ethyl 2-[[4-(2-chloro-4-formylphenyl)sulfanyl-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetate.
| Compound Name | ethyl 2-[[4-(2-chloro-4-formylphenyl)sulfanyl-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetate |
|---|---|
| PubChem CID | 20768127 |
| Molecular Formula | C21H21ClO4S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | ethyl 2-[[4-(2-chloro-4-formylphenyl)sulfanyl-5,6,7,8-tetrahydronaphthalen-1-yl]oxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Sc2ccc(C=O)cc2Cl)c2c1CCCC2 |
| InChI | InChI=1S/C21H21ClO4S/c1-2-25-21(24)13-26-18-8-10-19(16-6-4-3-5-15(16)18)27-20-9-7-14(12-23)11-17(20)22/h7-12H,2-6,13H2,1H3 |
| InChIKey | HGEIYBRXVTVBEL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|