C14H15NO3S — CID 87847363
methyl 2-[(4-thiocyanato-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate (PubChem CID 87847363) has the molecular formula C14H15NO3S and a molecular weight of 277.34 g/mol. Its IUPAC name is methyl 2-[(4-thiocyanato-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate.
| Compound Name | methyl 2-[(4-thiocyanato-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate |
|---|---|
| PubChem CID | 87847363 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | methyl 2-[(4-thiocyanato-5,6,7,8-tetrahydronaphthalen-1-yl)oxy]acetate |
| SMILES | COC(=O)COc1ccc(SC#N)c2c1CCCC2 |
| InChI | InChI=1S/C14H15NO3S/c1-17-14(16)8-18-12-6-7-13(19-9-15)11-5-3-2-4-10(11)12/h6-7H,2-5,8H2,1H3 |
| InChIKey | BOLRZZUKIOUFOM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|