C12H11NO3S — CID 22504786
2-[(7-thiocyanato-2,3-dihydro-1H-inden-4-yl)oxy]acetic acid (PubChem CID 22504786) has the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-[(7-thiocyanato-2,3-dihydro-1H-inden-4-yl)oxy]acetic acid.
| Compound Name | 2-[(7-thiocyanato-2,3-dihydro-1H-inden-4-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 22504786 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-[(7-thiocyanato-2,3-dihydro-1H-inden-4-yl)oxy]acetic acid |
| SMILES | N#CSc1ccc(OCC(=O)O)c2c1CCC2 |
| InChI | InChI=1S/C12H11NO3S/c13-7-17-11-5-4-10(16-6-12(14)15)8-2-1-3-9(8)11/h4-5H,1-3,6H2,(H,14,15) |
| InChIKey | LQZUWOSLDNJNMM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|