About 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid
2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid (PubChem CID 54098560) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid.
Molecular Properties
| Compound Name | 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid |
| PubChem CID | 54098560 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid |
| SMILES | O=C(O)COc1ccc(O)c2c1CC2 |
| InChI | InChI=1S/C10H10O4/c11-8-3-4-9(14-5-10(12)13)7-2-1-6(7)8/h3-4,11H,1-2,5H2,(H,12,13) |
| InChIKey | BJOSOVADMCTMDM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid?
The IUPAC name of 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid (CID 54098560) is 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid.
What is the SMILES notation for 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid?
The canonical SMILES for 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid is O=C(O)COc1ccc(O)c2c1CC2.
What is the InChIKey of 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid?
The InChIKey is BJOSOVADMCTMDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c11-8-3-4-9(14-5-10(12)13)7-2-1-6(7)8/h3-4,11H,1-2,5H2,(H,12,13).
What are the key properties of 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid?
2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid has a molecular weight of 194.19 g/mol, XLogP of 0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-hydroxy-2-bicyclo[4.2.0]octa-1,3,5-trienyl)oxy]acetic acid is sourced from PubChem (CID 54098560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).