C19H20O4S2 — CID 22504803
2-[[7-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-2,3-dihydro-1H-inden-4-yl]oxy]acetic acid (PubChem CID 22504803) has the molecular formula C19H20O4S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[[7-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-2,3-dihydro-1H-inden-4-yl]oxy]acetic acid.
| Compound Name | 2-[[7-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-2,3-dihydro-1H-inden-4-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 22504803 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-[[7-(4-oxo-4-thiophen-2-ylbutyl)sulfanyl-2,3-dihydro-1H-inden-4-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1ccc(SCCCC(=O)c2cccs2)c2c1CCC2 |
| InChI | InChI=1S/C19H20O4S2/c20-15(18-7-3-11-25-18)6-2-10-24-17-9-8-16(23-12-19(21)22)13-4-1-5-14(13)17/h3,7-9,11H,1-2,4-6,10,12H2,(H,21,22) |
| InChIKey | FENLCHUGQMHWBB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|