C18H22O4S6 — CID 20768425
S-[3-[2,3-bis(prop-2-enoylsulfanyl)propyldisulfanyl]-2-prop-2-enoylsulfanylpropyl] prop-2-enethioate (PubChem CID 20768425) has the molecular formula C18H22O4S6 and a molecular weight of 494.77 g/mol. Its IUPAC name is S-[3-[2,3-bis(prop-2-enoylsulfanyl)propyldisulfanyl]-2-prop-2-enoylsulfanylpropyl] prop-2-enethioate.
| Compound Name | S-[3-[2,3-bis(prop-2-enoylsulfanyl)propyldisulfanyl]-2-prop-2-enoylsulfanylpropyl] prop-2-enethioate |
|---|---|
| PubChem CID | 20768425 |
| Molecular Formula | C18H22O4S6 |
| Molecular Weight | 494.77 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | S-[3-[2,3-bis(prop-2-enoylsulfanyl)propyldisulfanyl]-2-prop-2-enoylsulfanylpropyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC(CSSCC(CSC(=O)C=C)SC(=O)C=C)SC(=O)C=C |
| InChI | InChI=1S/C18H22O4S6/c1-5-15(19)23-9-13(27-17(21)7-3)11-25-26-12-14(28-18(22)8-4)10-24-16(20)6-2/h5-8,13-14H,1-4,9-12H2 |
| InChIKey | ZQCFJFFAHGLKJN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.77 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|