C18H22O4S5 — CID 20768426
S-[3-[2,3-bis(prop-2-enoylsulfanyl)propylsulfanyl]-2-prop-2-enoylsulfanylpropyl] prop-2-enethioate (PubChem CID 20768426) has the molecular formula C18H22O4S5 and a molecular weight of 462.71 g/mol. Its IUPAC name is S-[3-[2,3-bis(prop-2-enoylsulfanyl)propylsulfanyl]-2-prop-2-enoylsulfanylpropyl] prop-2-enethioate.
| Compound Name | S-[3-[2,3-bis(prop-2-enoylsulfanyl)propylsulfanyl]-2-prop-2-enoylsulfanylpropyl] prop-2-enethioate |
|---|---|
| PubChem CID | 20768426 |
| Molecular Formula | C18H22O4S5 |
| Molecular Weight | 462.71 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | S-[3-[2,3-bis(prop-2-enoylsulfanyl)propylsulfanyl]-2-prop-2-enoylsulfanylpropyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC(CSCC(CSC(=O)C=C)SC(=O)C=C)SC(=O)C=C |
| InChI | InChI=1S/C18H22O4S5/c1-5-15(19)24-11-13(26-17(21)7-3)9-23-10-14(27-18(22)8-4)12-25-16(20)6-2/h5-8,13-14H,1-4,9-12H2 |
| InChIKey | RWVRTECOYVQCIO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.71 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|