C12H18O2S5 — CID 20768455
S-[3-(3-prop-2-enoylsulfanyl-2-sulfanylpropyl)sulfanyl-2-sulfanylpropyl] prop-2-enethioate (PubChem CID 20768455) has the molecular formula C12H18O2S5 and a molecular weight of 354.61 g/mol. Its IUPAC name is S-[3-(3-prop-2-enoylsulfanyl-2-sulfanylpropyl)sulfanyl-2-sulfanylpropyl] prop-2-enethioate.
| Compound Name | S-[3-(3-prop-2-enoylsulfanyl-2-sulfanylpropyl)sulfanyl-2-sulfanylpropyl] prop-2-enethioate |
|---|---|
| PubChem CID | 20768455 |
| Molecular Formula | C12H18O2S5 |
| Molecular Weight | 354.61 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | S-[3-(3-prop-2-enoylsulfanyl-2-sulfanylpropyl)sulfanyl-2-sulfanylpropyl] prop-2-enethioate |
| SMILES | C=CC(=O)SCC(S)CSCC(S)CSC(=O)C=C |
| InChI | InChI=1S/C12H18O2S5/c1-3-11(13)18-7-9(15)5-17-6-10(16)8-19-12(14)4-2/h3-4,9-10,15-16H,1-2,5-8H2 |
| InChIKey | IFLZSPHSVOGYBG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|