C6H12N2O5S — CID 20769653
2-(methanesulfonamido)-4-(methylamino)-4-oxobutanoic acid (PubChem CID 20769653) has the molecular formula C6H12N2O5S and a molecular weight of 224.24 g/mol. Its IUPAC name is 2-(methanesulfonamido)-4-(methylamino)-4-oxobutanoic acid.
| Compound Name | 2-(methanesulfonamido)-4-(methylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20769653 |
| Molecular Formula | C6H12N2O5S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-(methanesulfonamido)-4-(methylamino)-4-oxobutanoic acid |
| SMILES | CNC(=O)CC(NS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C6H12N2O5S/c1-7-5(9)3-4(6(10)11)8-14(2,12)13/h4,8H,3H2,1-2H3,(H,7,9)(H,10,11) |
| InChIKey | UWNUMIPFGKHTCW-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |