C7H17NO5S2 — CID 20769763
N-(2-hydroxypropyl)-3-methylsulfonylpropane-1-sulfonamide (PubChem CID 20769763) has the molecular formula C7H17NO5S2 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-3-methylsulfonylpropane-1-sulfonamide.
| Compound Name | N-(2-hydroxypropyl)-3-methylsulfonylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 20769763 |
| Molecular Formula | C7H17NO5S2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | N-(2-hydroxypropyl)-3-methylsulfonylpropane-1-sulfonamide |
| SMILES | CC(O)CNS(=O)(=O)CCCS(C)(=O)=O |
| InChI | InChI=1S/C7H17NO5S2/c1-7(9)6-8-15(12,13)5-3-4-14(2,10)11/h7-9H,3-6H2,1-2H3 |
| InChIKey | PZTCDHVAEFNPHG-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |