C11H13N3S — CID 20771952
2-[5-(2-methylpropyl)-2-pyridinyl]-1,3,4-thiadiazole (PubChem CID 20771952) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-[5-(2-methylpropyl)-2-pyridinyl]-1,3,4-thiadiazole.
| Compound Name | 2-[5-(2-methylpropyl)-2-pyridinyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 20771952 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-[5-(2-methylpropyl)-2-pyridinyl]-1,3,4-thiadiazole |
| SMILES | CC(C)Cc1ccc(-c2nncs2)nc1 |
| InChI | InChI=1S/C11H13N3S/c1-8(2)5-9-3-4-10(12-6-9)11-14-13-7-15-11/h3-4,6-8H,5H2,1-2H3 |
| InChIKey | SSMIXIBNHKKKRR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |