C12H14N2S — CID 20771962
2-[5-(2-methylpropyl)-2-pyridinyl]-1,3-thiazole (PubChem CID 20771962) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-[5-(2-methylpropyl)-2-pyridinyl]-1,3-thiazole.
| Compound Name | 2-[5-(2-methylpropyl)-2-pyridinyl]-1,3-thiazole |
|---|---|
| PubChem CID | 20771962 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-[5-(2-methylpropyl)-2-pyridinyl]-1,3-thiazole |
| SMILES | CC(C)Cc1ccc(-c2nccs2)nc1 |
| InChI | InChI=1S/C12H14N2S/c1-9(2)7-10-3-4-11(14-8-10)12-13-5-6-15-12/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | IJXAGWOWBLLCRW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |