C27H37N7O2 — CID 20777040
4-[[4-[5-methyl-3-(3-morpholin-4-ylpropylamino)-1-phenylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexan-1-ol (PubChem CID 20777040) has the molecular formula C27H37N7O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 4-[[4-[5-methyl-3-(3-morpholin-4-ylpropylamino)-1-phenylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[4-[5-methyl-3-(3-morpholin-4-ylpropylamino)-1-phenylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 20777040 |
| Molecular Formula | C27H37N7O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | 4-[[4-[5-methyl-3-(3-morpholin-4-ylpropylamino)-1-phenylpyrazol-4-yl]pyrimidin-2-yl]amino]cyclohexan-1-ol |
| SMILES | Cc1c(-c2ccnc(NC3CCC(O)CC3)n2)c(NCCCN2CCOCC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C27H37N7O2/c1-20-25(24-12-14-29-27(31-24)30-21-8-10-23(35)11-9-21)26(32-34(20)22-6-3-2-4-7-22)28-13-5-15-33-16-18-36-19-17-33/h2-4,6-7,12,14,21,23,35H,5,8-11,13,15-19H2,1H3,(H,28,32)(H,29,30,31) |
| InChIKey | LHZXILSCBIZIIO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|