C26H28N2O6S — CID 20778555
3,5-bis[(2,4-dimethylphenoxy)methylcarbamoyl]benzenesulfinic acid (PubChem CID 20778555) has the molecular formula C26H28N2O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is 3,5-bis[(2,4-dimethylphenoxy)methylcarbamoyl]benzenesulfinic acid.
| Compound Name | 3,5-bis[(2,4-dimethylphenoxy)methylcarbamoyl]benzenesulfinic acid |
|---|---|
| PubChem CID | 20778555 |
| Molecular Formula | C26H28N2O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 3,5-bis[(2,4-dimethylphenoxy)methylcarbamoyl]benzenesulfinic acid |
| SMILES | Cc1ccc(OCNC(=O)c2cc(C(=O)NCOc3ccc(C)cc3C)cc(S(=O)O)c2)c(C)c1 |
| InChI | InChI=1S/C26H28N2O6S/c1-16-5-7-23(18(3)9-16)33-14-27-25(29)20-11-21(13-22(12-20)35(31)32)26(30)28-15-34-24-8-6-17(2)10-19(24)4/h5-13H,14-15H2,1-4H3,(H,27,29)(H,28,30)(H,31,32) |
| InChIKey | CEHVSADMALIUDF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|