C25H27FN4O4S — CID 20779257
4-[3-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methylcinnolin-7-yl]oxypropyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 20779257) has the molecular formula C25H27FN4O4S and a molecular weight of 498.58 g/mol. Its IUPAC name is 4-[3-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methylcinnolin-7-yl]oxypropyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[3-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methylcinnolin-7-yl]oxypropyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 20779257 |
| Molecular Formula | C25H27FN4O4S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 4-[3-[4-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-6-methylcinnolin-7-yl]oxypropyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | Cc1cc2c(F)c(Oc3cnnc4cc(OCCCN5CCS(=O)(=O)CC5)c(C)cc34)ccc2[nH]1 |
| InChI | InChI=1S/C25H27FN4O4S/c1-16-12-18-21(14-23(16)33-9-3-6-30-7-10-35(31,32)11-8-30)29-27-15-24(18)34-22-5-4-20-19(25(22)26)13-17(2)28-20/h4-5,12-15,28H,3,6-11H2,1-2H3 |
| InChIKey | SIYPSVVYMSEUNY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|