C54H45N2Y+2 — CID 20779703
N-[4-[2,7-dimethyl-9-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]fluoren-9-yl]phenyl]-4-methyl-N-phenylaniline;yttrium(3+) (PubChem CID 20779703) has the molecular formula C54H45N2Y+2 and a molecular weight of 810.87 g/mol. Its IUPAC name is N-[4-[2,7-dimethyl-9-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]fluoren-9-yl]phenyl]-4-methyl-N-phenylaniline;yttrium(3+).
| Compound Name | N-[4-[2,7-dimethyl-9-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]fluoren-9-yl]phenyl]-4-methyl-N-phenylaniline;yttrium(3+) |
|---|---|
| PubChem CID | 20779703 |
| Molecular Formula | C54H45N2Y+2 |
| Molecular Weight | 810.87 g/mol |
| Exact Mass | 810.26 |
| IUPAC Name | N-[4-[2,7-dimethyl-9-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]fluoren-9-yl]phenyl]-4-methyl-N-phenylaniline;yttrium(3+) |
| SMILES | Cc1ccc(N(c2cc[c-]cc2)c2ccc(C3(c4ccc(N(c5ccc(C)cc5)c5ccc(C)cc5)cc4)c4cc(C)ccc4-c4ccc(C)cc43)cc2)cc1.[Y+3] |
| InChI | InChI=1S/C54H45N2.Y/c1-37-11-23-45(24-12-37)55(44-9-7-6-8-10-44)48-29-19-42(20-30-48)54(52-35-40(4)17-33-50(52)51-34-18-41(5)36-53(51)54)43-21-31-49(32-22-43)56(46-25-13-38(2)14-26-46)47-27-15-39(3)16-28-47;/h7-36H,1-5H3;/q-1;+3 |
| InChIKey | GIHWIYAAMHDSEB-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.87 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|