C24H26O8 — CID 20780595
2-methyl-1-oxo-5-phenyl-1-phenylmethoxyheptane-2,3,4-tricarboxylic acid (PubChem CID 20780595) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is 2-methyl-1-oxo-5-phenyl-1-phenylmethoxyheptane-2,3,4-tricarboxylic acid.
| Compound Name | 2-methyl-1-oxo-5-phenyl-1-phenylmethoxyheptane-2,3,4-tricarboxylic acid |
|---|---|
| PubChem CID | 20780595 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-methyl-1-oxo-5-phenyl-1-phenylmethoxyheptane-2,3,4-tricarboxylic acid |
| SMILES | CCC(C(=O)O)(c1ccccc1)C(C(=O)O)C(C(=O)O)C(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H26O8/c1-3-24(23(30)31,17-12-8-5-9-13-17)19(21(27)28)18(20(25)26)15(2)22(29)32-14-16-10-6-4-7-11-16/h4-13,15,18-19H,3,14H2,1-2H3,(H,25,26)(H,27,28)(H,30,31) |
| InChIKey | VWWJCLJGVPDNSK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |