C40H36F6N2O6 — CID 20782848
3-[5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylcyclohexyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-(4-methylcyclohexyl)benzoic acid (PubChem CID 20782848) has the molecular formula C40H36F6N2O6 and a molecular weight of 754.72 g/mol. Its IUPAC name is 3-[5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylcyclohexyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-(4-methylcyclohexyl)benzoic acid.
| Compound Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylcyclohexyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-(4-methylcyclohexyl)benzoic acid |
|---|---|
| PubChem CID | 20782848 |
| Molecular Formula | C40H36F6N2O6 |
| Molecular Weight | 754.72 g/mol |
| Exact Mass | 754.25 |
| IUPAC Name | 3-[5-[1,1,1,3,3,3-hexafluoro-2-[2-(4-methylcyclohexyl)-1,3-dioxoisoindol-5-yl]propan-2-yl]-1,3-dioxoisoindol-2-yl]-5-(4-methylcyclohexyl)benzoic acid |
| SMILES | CC1CCC(c2cc(C(=O)O)cc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)N(C5CCC(C)CC5)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)c2)CC1 |
| InChI | InChI=1S/C40H36F6N2O6/c1-20-3-7-22(8-4-20)23-15-24(37(53)54)17-28(16-23)48-34(50)30-14-10-26(19-32(30)36(48)52)38(39(41,42)43,40(44,45)46)25-9-13-29-31(18-25)35(51)47(33(29)49)27-11-5-21(2)6-12-27/h9-10,13-22,27H,3-8,11-12H2,1-2H3,(H,53,54) |
| InChIKey | QGQVNZJFINMBLM-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.72 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|