C16H15N2O4+ — CID 20783409
3-(4-methoxyphenyl)-8-methyl-6-nitro-2H-1,3-benzoxazin-3-ium (PubChem CID 20783409) has the molecular formula C16H15N2O4+ and a molecular weight of 299.31 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-8-methyl-6-nitro-2H-1,3-benzoxazin-3-ium.
| Compound Name | 3-(4-methoxyphenyl)-8-methyl-6-nitro-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 20783409 |
| Molecular Formula | C16H15N2O4+ |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-(4-methoxyphenyl)-8-methyl-6-nitro-2H-1,3-benzoxazin-3-ium |
| SMILES | COc1ccc([N+]2=Cc3cc([N+](=O)[O-])cc(C)c3OC2)cc1 |
| InChI | InChI=1S/C16H15N2O4/c1-11-7-14(18(19)20)8-12-9-17(10-22-16(11)12)13-3-5-15(21-2)6-4-13/h3-9H,10H2,1-2H3/q+1 |
| InChIKey | KFZFKNMJKPNZGR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|