C18H11F9NO+ — CID 20783752
8-methyl-3-[2,4,6-tris(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium (PubChem CID 20783752) has the molecular formula C18H11F9NO+ and a molecular weight of 428.27 g/mol. Its IUPAC name is 8-methyl-3-[2,4,6-tris(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium.
| Compound Name | 8-methyl-3-[2,4,6-tris(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 20783752 |
| Molecular Formula | C18H11F9NO+ |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 8-methyl-3-[2,4,6-tris(trifluoromethyl)phenyl]-2H-1,3-benzoxazin-3-ium |
| SMILES | Cc1cccc2c1OC[N+](c1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F)=C2 |
| InChI | InChI=1S/C18H11F9NO/c1-9-3-2-4-10-7-28(8-29-15(9)10)14-12(17(22,23)24)5-11(16(19,20)21)6-13(14)18(25,26)27/h2-7H,8H2,1H3/q+1 |
| InChIKey | KONPROBAGYZJGD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|