C8H11N3O2 — CID 20784612
1,1-dimethyl-3-(6-oxo-1H-pyridin-3-yl)urea (PubChem CID 20784612) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1,1-dimethyl-3-(6-oxo-1H-pyridin-3-yl)urea.
| Compound Name | 1,1-dimethyl-3-(6-oxo-1H-pyridin-3-yl)urea |
|---|---|
| PubChem CID | 20784612 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1,1-dimethyl-3-(6-oxo-1H-pyridin-3-yl)urea |
| SMILES | CN(C)C(=O)Nc1ccc(=O)[nH]c1 |
| InChI | InChI=1S/C8H11N3O2/c1-11(2)8(13)10-6-3-4-7(12)9-5-6/h3-5H,1-2H3,(H,9,12)(H,10,13) |
| InChIKey | VCEAZXJDGAWWET-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |