C9H11ClN2O — CID 10536010
3-(4-chloro-2-deuteriophenyl)-1,1-dimethylurea (PubChem CID 10536010) has the molecular formula C9H11ClN2O and a molecular weight of 199.66 g/mol. Its IUPAC name is 3-(4-chloro-2-deuteriophenyl)-1,1-dimethylurea.
| Compound Name | 3-(4-chloro-2-deuteriophenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 10536010 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 199.66 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3-(4-chloro-2-deuteriophenyl)-1,1-dimethylurea |
| SMILES | [2H]c1cc(Cl)ccc1NC(=O)N(C)C |
| InChI | InChI=1S/C9H11ClN2O/c1-12(2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13)/i5D |
| InChIKey | BMLIZLVNXIYGCK-UICOGKGYSA-N |
| XLogP | 2.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.66 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |