C12H12ClN3O2 — CID 110402559
3-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-1,1-dimethylurea (PubChem CID 110402559) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-1,1-dimethylurea.
| Compound Name | 3-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 110402559 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1oncc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H12ClN3O2/c1-16(2)12(17)15-11-10(7-14-18-11)8-3-5-9(13)6-4-8/h3-7H,1-2H3,(H,15,17) |
| InChIKey | ZQOOIWUHEQZUJJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |