C22H20N2O3S — CID 20788204
2-(3,5-dimethoxyanilino)-1-phenothiazin-10-ylethanone (PubChem CID 20788204) has the molecular formula C22H20N2O3S and a molecular weight of 392.48 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-1-phenothiazin-10-ylethanone.
| Compound Name | 2-(3,5-dimethoxyanilino)-1-phenothiazin-10-ylethanone |
|---|---|
| PubChem CID | 20788204 |
| Molecular Formula | C22H20N2O3S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-1-phenothiazin-10-ylethanone |
| SMILES | COc1cc(NCC(=O)N2c3ccccc3Sc3ccccc32)cc(OC)c1 |
| InChI | InChI=1S/C22H20N2O3S/c1-26-16-11-15(12-17(13-16)27-2)23-14-22(25)24-18-7-3-5-9-20(18)28-21-10-6-4-8-19(21)24/h3-13,23H,14H2,1-2H3 |
| InChIKey | KXFZNDLAFKUWSW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |