C21H18N2O3S — CID 4194410
N-(2,5-dimethoxyphenyl)phenothiazine-10-carboxamide (PubChem CID 4194410) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)phenothiazine-10-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)phenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 4194410 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)phenothiazine-10-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)N2c3ccccc3Sc3ccccc32)c1 |
| InChI | InChI=1S/C21H18N2O3S/c1-25-14-11-12-18(26-2)15(13-14)22-21(24)23-16-7-3-5-9-19(16)27-20-10-6-4-8-17(20)23/h3-13H,1-2H3,(H,22,24) |
| InChIKey | QVMLVZQWHUAVPD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |