C22H17ClN4O — CID 20788358
(E)-1-phenyl-3-[3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridin-1-ium-1-yl]prop-2-en-1-one chloride (PubChem CID 20788358) has the molecular formula C22H17ClN4O and a molecular weight of 388.86 g/mol. Its IUPAC name is (E)-1-phenyl-3-[3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridin-1-ium-1-yl]prop-2-en-1-one chloride.
| Compound Name | (E)-1-phenyl-3-[3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridin-1-ium-1-yl]prop-2-en-1-one chloride |
|---|---|
| PubChem CID | 20788358 |
| Molecular Formula | C22H17ClN4O |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (E)-1-phenyl-3-[3-(5-phenyl-1H-1,2,4-triazol-3-yl)pyridin-1-ium-1-yl]prop-2-en-1-one chloride |
| SMILES | O=C(/C=C/[n+]1cccc(-c2n[nH]c(-c3ccccc3)n2)c1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H17N4O.ClH/c27-20(17-8-3-1-4-9-17)13-15-26-14-7-12-19(16-26)22-23-21(24-25-22)18-10-5-2-6-11-18;/h1-16H,(H,23,24,25);1H/q+1;/p-1/b15-13+; |
| InChIKey | WXOMDGJEVLNHBC-GVYCEHEKSA-M |
| XLogP | 0.78 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|