About (3-phenylsulfanylphenyl) phosphanylformate
(3-phenylsulfanylphenyl) phosphanylformate (PubChem CID 20789561) has the molecular formula C13H11O2PS
and a molecular weight of 262.27 g/mol. Its IUPAC name is (3-phenylsulfanylphenyl) phosphanylformate.
Molecular Properties
| Compound Name | (3-phenylsulfanylphenyl) phosphanylformate |
| PubChem CID | 20789561 |
| Molecular Formula | C13H11O2PS |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (3-phenylsulfanylphenyl) phosphanylformate |
| SMILES | O=C(P)Oc1cccc(Sc2ccccc2)c1 |
| InChI | InChI=1S/C13H11O2PS/c14-13(16)15-10-5-4-8-12(9-10)17-11-6-2-1-3-7-11/h1-9H,16H2 |
| InChIKey | BSLKZBGDWIPNHB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-phenylsulfanylphenyl) phosphanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenylsulfanylphenyl) phosphanylformate?
The IUPAC name of (3-phenylsulfanylphenyl) phosphanylformate (CID 20789561) is (3-phenylsulfanylphenyl) phosphanylformate.
What is the SMILES notation for (3-phenylsulfanylphenyl) phosphanylformate?
The canonical SMILES for (3-phenylsulfanylphenyl) phosphanylformate is O=C(P)Oc1cccc(Sc2ccccc2)c1.
What is the InChIKey of (3-phenylsulfanylphenyl) phosphanylformate?
The InChIKey is BSLKZBGDWIPNHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11O2PS/c14-13(16)15-10-5-4-8-12(9-10)17-11-6-2-1-3-7-11/h1-9H,16H2.
What are the key properties of (3-phenylsulfanylphenyl) phosphanylformate?
(3-phenylsulfanylphenyl) phosphanylformate has a molecular weight of 262.27 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenylsulfanylphenyl) phosphanylformate is sourced from PubChem (CID 20789561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).