C13H12O5 — CID 20789710
spiro[11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,3'-oxolane]-2',5'-dione (PubChem CID 20789710) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is spiro[11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,3'-oxolane]-2',5'-dione.
| Compound Name | spiro[11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,3'-oxolane]-2',5'-dione |
|---|---|
| PubChem CID | 20789710 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | spiro[11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-4-ene-9,3'-oxolane]-2',5'-dione |
| SMILES | O=C1CC2(CC3OC2C2C4C=CC(O4)C32)C(=O)O1 |
| InChI | InChI=1S/C13H12O5/c14-8-4-13(12(15)18-8)3-7-9-5-1-2-6(16-5)10(9)11(13)17-7/h1-2,5-7,9-11H,3-4H2 |
| InChIKey | OSQHYYPLGZOCBB-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|