C12H20N2O8 — CID 20789776
2-[[4-carboxy-4-(carboxymethylamino)-2-methylbutan-2-yl]amino]butanedioic acid (PubChem CID 20789776) has the molecular formula C12H20N2O8 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2-[[4-carboxy-4-(carboxymethylamino)-2-methylbutan-2-yl]amino]butanedioic acid.
| Compound Name | 2-[[4-carboxy-4-(carboxymethylamino)-2-methylbutan-2-yl]amino]butanedioic acid |
|---|---|
| PubChem CID | 20789776 |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[[4-carboxy-4-(carboxymethylamino)-2-methylbutan-2-yl]amino]butanedioic acid |
| SMILES | CC(C)(CC(NCC(=O)O)C(=O)O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20N2O8/c1-12(2,14-6(10(19)20)3-8(15)16)4-7(11(21)22)13-5-9(17)18/h6-7,13-14H,3-5H2,1-2H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | YRBOLJJYFWNYGS-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |