C32H28F5N5O5S — CID 20789821
3-[[3-[3-[4-(2,4-dimethylphenoxy)butylamino]oxycarbonylphenyl]-6-(2,3,4,5,6-pentafluorophenyl)-5H-pyrazolo[5,1-c][1,2,4]triazol-7-yl]sulfanyl]propanoic acid (PubChem CID 20789821) has the molecular formula C32H28F5N5O5S and a molecular weight of 689.66 g/mol. Its IUPAC name is 3-[[3-[3-[4-(2,4-dimethylphenoxy)butylamino]oxycarbonylphenyl]-6-(2,3,4,5,6-pentafluorophenyl)-5H-pyrazolo[5,1-c][1,2,4]triazol-7-yl]sulfanyl]propanoic acid.
| Compound Name | 3-[[3-[3-[4-(2,4-dimethylphenoxy)butylamino]oxycarbonylphenyl]-6-(2,3,4,5,6-pentafluorophenyl)-5H-pyrazolo[5,1-c][1,2,4]triazol-7-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 20789821 |
| Molecular Formula | C32H28F5N5O5S |
| Molecular Weight | 689.66 g/mol |
| Exact Mass | 689.17 |
| IUPAC Name | 3-[[3-[3-[4-(2,4-dimethylphenoxy)butylamino]oxycarbonylphenyl]-6-(2,3,4,5,6-pentafluorophenyl)-5H-pyrazolo[5,1-c][1,2,4]triazol-7-yl]sulfanyl]propanoic acid |
| SMILES | Cc1ccc(OCCCCNOC(=O)c2cccc(-c3nnc4c(SCCC(=O)O)c(-c5c(F)c(F)c(F)c(F)c5F)[nH]n34)c2)c(C)c1 |
| InChI | InChI=1S/C32H28F5N5O5S/c1-16-8-9-20(17(2)14-16)46-12-4-3-11-38-47-32(45)19-7-5-6-18(15-19)30-39-40-31-29(48-13-10-21(43)44)28(41-42(30)31)22-23(33)25(35)27(37)26(36)24(22)34/h5-9,14-15,38,41H,3-4,10-13H2,1-2H3,(H,43,44) |
| InChIKey | XPQVDKWSKSMRPC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.66 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|